C20H25Br2N3O2 — CID 98557427
(1R,7R,8S,9S,10R,11S)-9,10-dibromo-4-[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-2,4,6-triazatetracyclo[5.4.2.02,6.08,11]tridec-12-ene-3,5-dione (PubChem CID 98557427) has the molecular formula C20H25Br2N3O2 and a molecular weight of 499.25 g/mol. Its IUPAC name is (1R,7R,8S,9S,10R,11S)-9,10-dibromo-4-[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-2,4,6-triazatetracyclo[5.4.2.02,6.08,11]tridec-12-ene-3,5-dione.
| Compound Name | (1R,7R,8S,9S,10R,11S)-9,10-dibromo-4-[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-2,4,6-triazatetracyclo[5.4.2.02,6.08,11]tridec-12-ene-3,5-dione |
|---|---|
| PubChem CID | 98557427 |
| Molecular Formula | C20H25Br2N3O2 |
| Molecular Weight | 499.25 g/mol |
| Exact Mass | 497.03 |
| IUPAC Name | (1R,7R,8S,9S,10R,11S)-9,10-dibromo-4-[(1S,2R,4S)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl]-2,4,6-triazatetracyclo[5.4.2.02,6.08,11]tridec-12-ene-3,5-dione |
| SMILES | CC1(C)[C@H]2CC[C@]1(C)[C@H](n1c(=O)n3n(c1=O)[C@@H]1C=C[C@@H]3[C@H]3[C@H](Br)[C@H](Br)[C@@H]31)C2 |
| InChI | InChI=1S/C20H25Br2N3O2/c1-19(2)9-6-7-20(19,3)12(8-9)23-17(26)24-10-4-5-11(25(24)18(23)27)14-13(10)15(21)16(14)22/h4-5,9-16H,6-8H2,1-3H3/t9-,10+,11+,12+,13+,14+,15-,16+,20+/m0/s1 |
| InChIKey | QLKUDAZHTILURQ-CNLABUKLSA-N |
| XLogP | 3.64 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.25 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|