C13H17N3O — CID 12503570
5,6,6-trimethyl-3-phenyl-7,7a-dihydropyrazolo[1,5-d][1,2,4]oxadiazole (PubChem CID 12503570) has the molecular formula C13H17N3O and a molecular weight of 231.30 g/mol. Its IUPAC name is 5,6,6-trimethyl-3-phenyl-7,7a-dihydropyrazolo[1,5-d][1,2,4]oxadiazole.
| Compound Name | 5,6,6-trimethyl-3-phenyl-7,7a-dihydropyrazolo[1,5-d][1,2,4]oxadiazole |
|---|---|
| PubChem CID | 12503570 |
| Molecular Formula | C13H17N3O |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.14 |
| IUPAC Name | 5,6,6-trimethyl-3-phenyl-7,7a-dihydropyrazolo[1,5-d][1,2,4]oxadiazole |
| SMILES | CN1N2C(c3ccccc3)=NOC2CC1(C)C |
| InChI | InChI=1S/C13H17N3O/c1-13(2)9-11-16(15(13)3)12(14-17-11)10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3 |
| InChIKey | VBJNCYLQWATASP-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 28.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |