C33H33NO7 — CID 125036675
[(8R,9S,13S,14R,17R)-3-(2-benzoyl-4-nitrophenoxy)-2-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate (PubChem CID 125036675) has the molecular formula C33H33NO7 and a molecular weight of 555.63 g/mol. Its IUPAC name is [(8R,9S,13S,14R,17R)-3-(2-benzoyl-4-nitrophenoxy)-2-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate.
| Compound Name | [(8R,9S,13S,14R,17R)-3-(2-benzoyl-4-nitrophenoxy)-2-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
|---|---|
| PubChem CID | 125036675 |
| Molecular Formula | C33H33NO7 |
| Molecular Weight | 555.63 g/mol |
| Exact Mass | 555.23 |
| IUPAC Name | [(8R,9S,13S,14R,17R)-3-(2-benzoyl-4-nitrophenoxy)-2-hydroxy-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-17-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC[C@@H]2[C@@H]3CCc4cc(Oc5ccc([N+](=O)[O-])cc5C(=O)c5ccccc5)c(O)cc4[C@H]3CC[C@@]21C |
| InChI | InChI=1S/C33H33NO7/c1-19(35)40-31-13-11-27-24-10-8-21-16-30(28(36)18-25(21)23(24)14-15-33(27,31)2)41-29-12-9-22(34(38)39)17-26(29)32(37)20-6-4-3-5-7-20/h3-7,9,12,16-18,23-24,27,31,36H,8,10-11,13-15H2,1-2H3/t23-,24+,27+,31+,33-/m0/s1 |
| InChIKey | XZJHCOJNVJPBDL-WFVKFGATSA-N |
| XLogP | 7.11 |
| TPSA | 115.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.63 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|