C18H29ClN2 — CID 125047352
N-[[(4R)-7-chloro-2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl]methyl]ethanamine (PubChem CID 125047352) has the molecular formula C18H29ClN2 and a molecular weight of 308.90 g/mol. Its IUPAC name is N-[[(4R)-7-chloro-2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl]methyl]ethanamine.
| Compound Name | N-[[(4R)-7-chloro-2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 125047352 |
| Molecular Formula | C18H29ClN2 |
| Molecular Weight | 308.90 g/mol |
| Exact Mass | 308.20 |
| IUPAC Name | N-[[(4R)-7-chloro-2,2,4-trimethyl-1-propan-2-yl-3,4-dihydroquinolin-6-yl]methyl]ethanamine |
| SMILES | CCNCc1cc2c(cc1Cl)N(C(C)C)C(C)(C)C[C@H]2C |
| InChI | InChI=1S/C18H29ClN2/c1-7-20-11-14-8-15-13(4)10-18(5,6)21(12(2)3)17(15)9-16(14)19/h8-9,12-13,20H,7,10-11H2,1-6H3/t13-/m1/s1 |
| InChIKey | XYEARQRAVDNWER-CYBMUJFWSA-N |
| XLogP | 4.95 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.90 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|