C19H22ClN — CID 12507138
N,N-dimethyl-2-(1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenyl)ethanamine;hydrochloride (PubChem CID 12507138) has the molecular formula C19H22ClN and a molecular weight of 299.85 g/mol. Its IUPAC name is N,N-dimethyl-2-(1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenyl)ethanamine;hydrochloride.
| Compound Name | N,N-dimethyl-2-(1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenyl)ethanamine;hydrochloride |
|---|---|
| PubChem CID | 12507138 |
| Molecular Formula | C19H22ClN |
| Molecular Weight | 299.85 g/mol |
| Exact Mass | 299.14 |
| IUPAC Name | N,N-dimethyl-2-(1-tetracyclo[6.6.1.02,7.09,14]pentadeca-2,4,6,9,11,13-hexaenyl)ethanamine;hydrochloride |
| SMILES | CN(C)CCC12CC(c3ccccc31)c1ccccc12.Cl |
| InChI | InChI=1S/C19H21N.ClH/c1-20(2)12-11-19-13-16(14-7-3-5-9-17(14)19)15-8-4-6-10-18(15)19;/h3-10,16H,11-13H2,1-2H3;1H |
| InChIKey | OAJRZORPBVSUEX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.85 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |