C23H23N3O2S2 — CID 125079774
(4S,5S)-1-[[(2R)-oxolan-2-yl]methyl]-5-(5-phenylsulfanylfuran-2-yl)-4-pyridin-2-ylimidazolidine-2-thione (PubChem CID 125079774) has the molecular formula C23H23N3O2S2 and a molecular weight of 437.59 g/mol. Its IUPAC name is (4S,5S)-1-[[(2R)-oxolan-2-yl]methyl]-5-(5-phenylsulfanylfuran-2-yl)-4-pyridin-2-ylimidazolidine-2-thione.
| Compound Name | (4S,5S)-1-[[(2R)-oxolan-2-yl]methyl]-5-(5-phenylsulfanylfuran-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
|---|---|
| PubChem CID | 125079774 |
| Molecular Formula | C23H23N3O2S2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | (4S,5S)-1-[[(2R)-oxolan-2-yl]methyl]-5-(5-phenylsulfanylfuran-2-yl)-4-pyridin-2-ylimidazolidine-2-thione |
| SMILES | S=C1N[C@H](c2ccccn2)[C@@H](c2ccc(Sc3ccccc3)o2)N1C[C@H]1CCCO1 |
| InChI | InChI=1S/C23H23N3O2S2/c29-23-25-21(18-10-4-5-13-24-18)22(26(23)15-16-7-6-14-27-16)19-11-12-20(28-19)30-17-8-2-1-3-9-17/h1-5,8-13,16,21-22H,6-7,14-15H2,(H,25,29)/t16-,21-,22-/m1/s1 |
| InChIKey | OLTHQQSJZGWHMI-NPFVIJTESA-N |
| XLogP | 4.98 |
| TPSA | 50.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|