C19H12Cl2N4S — CID 125115239
(11R)-11-chloro-14-(4-chlorophenyl)-6-methyl-17-thia-2,12,13,15-tetrazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),2,4,6,8,13,15-heptaene (PubChem CID 125115239) has the molecular formula C19H12Cl2N4S and a molecular weight of 399.31 g/mol. Its IUPAC name is (11R)-11-chloro-14-(4-chlorophenyl)-6-methyl-17-thia-2,12,13,15-tetrazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),2,4,6,8,13,15-heptaene.
| Compound Name | (11R)-11-chloro-14-(4-chlorophenyl)-6-methyl-17-thia-2,12,13,15-tetrazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),2,4,6,8,13,15-heptaene |
|---|---|
| PubChem CID | 125115239 |
| Molecular Formula | C19H12Cl2N4S |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 398.02 |
| IUPAC Name | (11R)-11-chloro-14-(4-chlorophenyl)-6-methyl-17-thia-2,12,13,15-tetrazatetracyclo[8.7.0.03,8.012,16]heptadeca-1(10),2,4,6,8,13,15-heptaene |
| SMILES | Cc1ccc2nc3c(cc2c1)[C@@H](Cl)n1nc(-c2ccc(Cl)cc2)nc1S3 |
| InChI | InChI=1S/C19H12Cl2N4S/c1-10-2-7-15-12(8-10)9-14-16(21)25-19(26-18(14)22-15)23-17(24-25)11-3-5-13(20)6-4-11/h2-9,16H,1H3/t16-/m0/s1 |
| InChIKey | XPYYBYYJKBEKNP-INIZCTEOSA-N |
| XLogP | 5.71 |
| TPSA | 43.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|