C15H18BrF2NO2 — CID 125117359
ethyl (3R,4R)-1-benzyl-4-(bromomethyl)-3,4-difluoropyrrolidine-3-carboxylate (PubChem CID 125117359) has the molecular formula C15H18BrF2NO2 and a molecular weight of 362.21 g/mol. Its IUPAC name is ethyl (3R,4R)-1-benzyl-4-(bromomethyl)-3,4-difluoropyrrolidine-3-carboxylate.
| Compound Name | ethyl (3R,4R)-1-benzyl-4-(bromomethyl)-3,4-difluoropyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 125117359 |
| Molecular Formula | C15H18BrF2NO2 |
| Molecular Weight | 362.21 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | ethyl (3R,4R)-1-benzyl-4-(bromomethyl)-3,4-difluoropyrrolidine-3-carboxylate |
| SMILES | CCOC(=O)[C@]1(F)CN(Cc2ccccc2)C[C@]1(F)CBr |
| InChI | InChI=1S/C15H18BrF2NO2/c1-2-21-13(20)15(18)11-19(10-14(15,17)9-16)8-12-6-4-3-5-7-12/h3-7H,2,8-11H2,1H3/t14-,15-/m1/s1 |
| InChIKey | ZLUQUKXGDRXZNC-HUUCEWRRSA-N |
| XLogP | 2.88 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.21 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|