C24H22O11 — CID 125121041
(2S)-2-[4-[5,7-bis[(2-methoxyacetyl)oxy]-4-oxochromen-3-yl]phenyl]-2-methoxyacetic acid (PubChem CID 125121041) has the molecular formula C24H22O11 and a molecular weight of 486.43 g/mol. Its IUPAC name is (2S)-2-[4-[5,7-bis[(2-methoxyacetyl)oxy]-4-oxochromen-3-yl]phenyl]-2-methoxyacetic acid.
| Compound Name | (2S)-2-[4-[5,7-bis[(2-methoxyacetyl)oxy]-4-oxochromen-3-yl]phenyl]-2-methoxyacetic acid |
|---|---|
| PubChem CID | 125121041 |
| Molecular Formula | C24H22O11 |
| Molecular Weight | 486.43 g/mol |
| Exact Mass | 486.12 |
| IUPAC Name | (2S)-2-[4-[5,7-bis[(2-methoxyacetyl)oxy]-4-oxochromen-3-yl]phenyl]-2-methoxyacetic acid |
| SMILES | COCC(=O)Oc1cc(OC(=O)COC)c2c(=O)c(-c3ccc([C@H](OC)C(=O)O)cc3)coc2c1 |
| InChI | InChI=1S/C24H22O11/c1-30-11-19(25)34-15-8-17-21(18(9-15)35-20(26)12-31-2)22(27)16(10-33-17)13-4-6-14(7-5-13)23(32-3)24(28)29/h4-10,23H,11-12H2,1-3H3,(H,28,29)/t23-/m0/s1 |
| InChIKey | HTXHRQRACIWXGH-QHCPKHFHSA-N |
| XLogP | 2.34 |
| TPSA | 147.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.43 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|