C27H24N2O6 — CID 125122875
methyl 2-[(9R)-6-[2-(3,4-dihydroxyphenyl)ethyl]-5-methyl-7-oxo-2-oxa-6,18-diazatetracyclo[8.8.0.03,8.012,17]octadeca-1(18),3(8),4,10,12,14,16-heptaen-9-yl]acetate (PubChem CID 125122875) has the molecular formula C27H24N2O6 and a molecular weight of 472.50 g/mol. Its IUPAC name is methyl 2-[(9R)-6-[2-(3,4-dihydroxyphenyl)ethyl]-5-methyl-7-oxo-2-oxa-6,18-diazatetracyclo[8.8.0.03,8.012,17]octadeca-1(18),3(8),4,10,12,14,16-heptaen-9-yl]acetate.
| Compound Name | methyl 2-[(9R)-6-[2-(3,4-dihydroxyphenyl)ethyl]-5-methyl-7-oxo-2-oxa-6,18-diazatetracyclo[8.8.0.03,8.012,17]octadeca-1(18),3(8),4,10,12,14,16-heptaen-9-yl]acetate |
|---|---|
| PubChem CID | 125122875 |
| Molecular Formula | C27H24N2O6 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.16 |
| IUPAC Name | methyl 2-[(9R)-6-[2-(3,4-dihydroxyphenyl)ethyl]-5-methyl-7-oxo-2-oxa-6,18-diazatetracyclo[8.8.0.03,8.012,17]octadeca-1(18),3(8),4,10,12,14,16-heptaen-9-yl]acetate |
| SMILES | COC(=O)C[C@@H]1c2cc3ccccc3nc2Oc2cc(C)n(CCc3ccc(O)c(O)c3)c(=O)c21 |
| InChI | InChI=1S/C27H24N2O6/c1-15-11-23-25(27(33)29(15)10-9-16-7-8-21(30)22(31)12-16)18(14-24(32)34-2)19-13-17-5-3-4-6-20(17)28-26(19)35-23/h3-8,11-13,18,30-31H,9-10,14H2,1-2H3/t18-/m1/s1 |
| InChIKey | QVYPVPROGDCBDQ-GOSISDBHSA-N |
| XLogP | 4.16 |
| TPSA | 110.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|