C8H13NO6 — CID 125126383
(1R,5R,6S,7R,8R)-6,7,8-trihydroxy-1-(hydroxymethyl)-2-oxa-4-azabicyclo[3.3.1]nonan-3-one (PubChem CID 125126383) has the molecular formula C8H13NO6 and a molecular weight of 219.19 g/mol. Its IUPAC name is (1R,5R,6S,7R,8R)-6,7,8-trihydroxy-1-(hydroxymethyl)-2-oxa-4-azabicyclo[3.3.1]nonan-3-one.
| Compound Name | (1R,5R,6S,7R,8R)-6,7,8-trihydroxy-1-(hydroxymethyl)-2-oxa-4-azabicyclo[3.3.1]nonan-3-one |
|---|---|
| PubChem CID | 125126383 |
| Molecular Formula | C8H13NO6 |
| Molecular Weight | 219.19 g/mol |
| Exact Mass | 219.07 |
| IUPAC Name | (1R,5R,6S,7R,8R)-6,7,8-trihydroxy-1-(hydroxymethyl)-2-oxa-4-azabicyclo[3.3.1]nonan-3-one |
| SMILES | O=C1N[C@@H]2C[C@](CO)(O1)[C@H](O)[C@H](O)[C@H]2O |
| InChI | InChI=1S/C8H13NO6/c10-2-8-1-3(9-7(14)15-8)4(11)5(12)6(8)13/h3-6,10-13H,1-2H2,(H,9,14)/t3-,4+,5-,6-,8-/m1/s1 |
| InChIKey | FTAQFNFNHWVZOF-KYRVAOBLSA-N |
| XLogP | -2.69 |
| TPSA | 119.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.19 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |