C8H12BrNO6 — CID 151916836
4-bromo-6,7,8-trihydroxy-1-(hydroxymethyl)-2-oxa-4-azabicyclo[3.3.1]nonan-3-one (PubChem CID 151916836) has the molecular formula C8H12BrNO6 and a molecular weight of 298.09 g/mol. Its IUPAC name is 4-bromo-6,7,8-trihydroxy-1-(hydroxymethyl)-2-oxa-4-azabicyclo[3.3.1]nonan-3-one.
| Compound Name | 4-bromo-6,7,8-trihydroxy-1-(hydroxymethyl)-2-oxa-4-azabicyclo[3.3.1]nonan-3-one |
|---|---|
| PubChem CID | 151916836 |
| Molecular Formula | C8H12BrNO6 |
| Molecular Weight | 298.09 g/mol |
| Exact Mass | 296.98 |
| IUPAC Name | 4-bromo-6,7,8-trihydroxy-1-(hydroxymethyl)-2-oxa-4-azabicyclo[3.3.1]nonan-3-one |
| SMILES | O=C1OC2(CO)CC(C(O)C(O)C2O)N1Br |
| InChI | InChI=1S/C8H12BrNO6/c9-10-3-1-8(2-11,16-7(10)15)6(14)5(13)4(3)12/h3-6,11-14H,1-2H2 |
| InChIKey | SVXYAZRXGDKVFH-UHFFFAOYSA-N |
| XLogP | -1.67 |
| TPSA | 110.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.09 |
| LogP ≤ 5 | -1.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|