C25H31N5O3 — CID 125127002
(3S)-N-[(3,4-dimethoxyphenyl)methyl]-1-(7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1-yl)piperidine-3-carboxamide (PubChem CID 125127002) has the molecular formula C25H31N5O3 and a molecular weight of 449.56 g/mol. Its IUPAC name is (3S)-N-[(3,4-dimethoxyphenyl)methyl]-1-(7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-[(3,4-dimethoxyphenyl)methyl]-1-(7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 125127002 |
| Molecular Formula | C25H31N5O3 |
| Molecular Weight | 449.56 g/mol |
| Exact Mass | 449.24 |
| IUPAC Name | (3S)-N-[(3,4-dimethoxyphenyl)methyl]-1-(7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1-yl)piperidine-3-carboxamide |
| SMILES | COc1ccc(CNC(=O)[C@H]2CCCN(c3nccn4nc5c(c34)CCCC5)C2)cc1OC |
| InChI | InChI=1S/C25H31N5O3/c1-32-21-10-9-17(14-22(21)33-2)15-27-25(31)18-6-5-12-29(16-18)24-23-19-7-3-4-8-20(19)28-30(23)13-11-26-24/h9-11,13-14,18H,3-8,12,15-16H2,1-2H3,(H,27,31)/t18-/m0/s1 |
| InChIKey | KEHKXJQLYSAZAH-SFHVURJKSA-N |
| XLogP | 3.16 |
| TPSA | 80.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.56 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |