C25H29N5O — CID 125129193
(3S)-N-[(1R)-2,3-dihydro-1H-inden-1-yl]-1-(7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1-yl)piperidine-3-carboxamide (PubChem CID 125129193) has the molecular formula C25H29N5O and a molecular weight of 415.54 g/mol. Its IUPAC name is (3S)-N-[(1R)-2,3-dihydro-1H-inden-1-yl]-1-(7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-[(1R)-2,3-dihydro-1H-inden-1-yl]-1-(7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 125129193 |
| Molecular Formula | C25H29N5O |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | (3S)-N-[(1R)-2,3-dihydro-1H-inden-1-yl]-1-(7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1-yl)piperidine-3-carboxamide |
| SMILES | O=C(N[C@@H]1CCc2ccccc21)[C@H]1CCCN(c2nccn3nc4c(c23)CCCC4)C1 |
| InChI | InChI=1S/C25H29N5O/c31-25(27-21-12-11-17-6-1-2-8-19(17)21)18-7-5-14-29(16-18)24-23-20-9-3-4-10-22(20)28-30(23)15-13-26-24/h1-2,6,8,13,15,18,21H,3-5,7,9-12,14,16H2,(H,27,31)/t18-,21+/m0/s1 |
| InChIKey | ZZMSFCBNQJHBQE-GHTZIAJQSA-N |
| XLogP | 3.63 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |