C20H29N5O — CID 125128650
(3R)-N-butyl-1-(7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1-yl)piperidine-3-carboxamide (PubChem CID 125128650) has the molecular formula C20H29N5O and a molecular weight of 355.49 g/mol. Its IUPAC name is (3R)-N-butyl-1-(7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1-yl)piperidine-3-carboxamide.
| Compound Name | (3R)-N-butyl-1-(7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 125128650 |
| Molecular Formula | C20H29N5O |
| Molecular Weight | 355.49 g/mol |
| Exact Mass | 355.24 |
| IUPAC Name | (3R)-N-butyl-1-(7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1-yl)piperidine-3-carboxamide |
| SMILES | CCCCNC(=O)[C@@H]1CCCN(c2nccn3nc4c(c23)CCCC4)C1 |
| InChI | InChI=1S/C20H29N5O/c1-2-3-10-22-20(26)15-7-6-12-24(14-15)19-18-16-8-4-5-9-17(16)23-25(18)13-11-21-19/h11,13,15H,2-10,12,14H2,1H3,(H,22,26)/t15-/m1/s1 |
| InChIKey | WFKZGXXPPIRASE-OAHLLOKOSA-N |
| XLogP | 2.74 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.49 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|