C23H25F2N5O — CID 125127465
(3S)-N-[(2,4-difluorophenyl)methyl]-1-(7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1-yl)piperidine-3-carboxamide (PubChem CID 125127465) has the molecular formula C23H25F2N5O and a molecular weight of 425.48 g/mol. Its IUPAC name is (3S)-N-[(2,4-difluorophenyl)methyl]-1-(7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1-yl)piperidine-3-carboxamide.
| Compound Name | (3S)-N-[(2,4-difluorophenyl)methyl]-1-(7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1-yl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 125127465 |
| Molecular Formula | C23H25F2N5O |
| Molecular Weight | 425.48 g/mol |
| Exact Mass | 425.20 |
| IUPAC Name | (3S)-N-[(2,4-difluorophenyl)methyl]-1-(7,8,9,10-tetrahydropyrazino[1,2-b]indazol-1-yl)piperidine-3-carboxamide |
| SMILES | O=C(NCc1ccc(F)cc1F)[C@H]1CCCN(c2nccn3nc4c(c23)CCCC4)C1 |
| InChI | InChI=1S/C23H25F2N5O/c24-17-8-7-15(19(25)12-17)13-27-23(31)16-4-3-10-29(14-16)22-21-18-5-1-2-6-20(18)28-30(21)11-9-26-22/h7-9,11-12,16H,1-6,10,13-14H2,(H,27,31)/t16-/m0/s1 |
| InChIKey | NEIIDZJEPISSDY-INIZCTEOSA-N |
| XLogP | 3.42 |
| TPSA | 62.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.48 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |