C11H11N5O3 — CID 12513286
N-[(E)-(3,4-dimethyl-1,2-oxazol-5-yl)diazenyl]-4-nitroaniline (PubChem CID 12513286) has the molecular formula C11H11N5O3 and a molecular weight of 261.24 g/mol. Its IUPAC name is N-[(E)-(3,4-dimethyl-1,2-oxazol-5-yl)diazenyl]-4-nitroaniline.
| Compound Name | N-[(E)-(3,4-dimethyl-1,2-oxazol-5-yl)diazenyl]-4-nitroaniline |
|---|---|
| PubChem CID | 12513286 |
| Molecular Formula | C11H11N5O3 |
| Molecular Weight | 261.24 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | N-[(E)-(3,4-dimethyl-1,2-oxazol-5-yl)diazenyl]-4-nitroaniline |
| SMILES | Cc1noc(/N=N/Nc2ccc([N+](=O)[O-])cc2)c1C |
| InChI | InChI=1S/C11H11N5O3/c1-7-8(2)14-19-11(7)13-15-12-9-3-5-10(6-4-9)16(17)18/h3-6H,1-2H3,(H,12,13) |
| InChIKey | DSNBBIREFDSTJI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 105.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.24 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|