C16H20F3NO4 — CID 125141478
(2R,3S,5S)-N-[4-methoxy-3-(2,2,2-trifluoroethoxy)phenyl]-3,5-dimethyloxolane-2-carboxamide (PubChem CID 125141478) has the molecular formula C16H20F3NO4 and a molecular weight of 347.33 g/mol. Its IUPAC name is (2R,3S,5S)-N-[4-methoxy-3-(2,2,2-trifluoroethoxy)phenyl]-3,5-dimethyloxolane-2-carboxamide.
| Compound Name | (2R,3S,5S)-N-[4-methoxy-3-(2,2,2-trifluoroethoxy)phenyl]-3,5-dimethyloxolane-2-carboxamide |
|---|---|
| PubChem CID | 125141478 |
| Molecular Formula | C16H20F3NO4 |
| Molecular Weight | 347.33 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | (2R,3S,5S)-N-[4-methoxy-3-(2,2,2-trifluoroethoxy)phenyl]-3,5-dimethyloxolane-2-carboxamide |
| SMILES | COc1ccc(NC(=O)[C@@H]2O[C@@H](C)C[C@@H]2C)cc1OCC(F)(F)F |
| InChI | InChI=1S/C16H20F3NO4/c1-9-6-10(2)24-14(9)15(21)20-11-4-5-12(22-3)13(7-11)23-8-16(17,18)19/h4-5,7,9-10,14H,6,8H2,1-3H3,(H,20,21)/t9-,10-,14+/m0/s1 |
| InChIKey | ZKOHTJFRRCEQPP-PKFCDNJMSA-N |
| XLogP | 3.39 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.33 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |