C30H34N2O15 — CID 125154518
2-[2-[2-[2-[bis[2-(acetyloxymethoxy)-2-oxoethyl]amino]-4-(2-oxoethyl)phenoxy]ethoxy]-N-(carboxymethyl)anilino]acetic acid (PubChem CID 125154518) has the molecular formula C30H34N2O15 and a molecular weight of 662.60 g/mol. Its IUPAC name is 2-[2-[2-[2-[bis[2-(acetyloxymethoxy)-2-oxoethyl]amino]-4-(2-oxoethyl)phenoxy]ethoxy]-N-(carboxymethyl)anilino]acetic acid.
| Compound Name | 2-[2-[2-[2-[bis[2-(acetyloxymethoxy)-2-oxoethyl]amino]-4-(2-oxoethyl)phenoxy]ethoxy]-N-(carboxymethyl)anilino]acetic acid |
|---|---|
| PubChem CID | 125154518 |
| Molecular Formula | C30H34N2O15 |
| Molecular Weight | 662.60 g/mol |
| Exact Mass | 662.20 |
| IUPAC Name | 2-[2-[2-[2-[bis[2-(acetyloxymethoxy)-2-oxoethyl]amino]-4-(2-oxoethyl)phenoxy]ethoxy]-N-(carboxymethyl)anilino]acetic acid |
| SMILES | CC(=O)OCOC(=O)CN(CC(=O)OCOC(C)=O)c1cc(CC=O)ccc1OCCOc1ccccc1N(CC(=O)O)CC(=O)O |
| InChI | InChI=1S/C30H34N2O15/c1-20(34)44-18-46-29(40)16-32(17-30(41)47-19-45-21(2)35)24-13-22(9-10-33)7-8-26(24)43-12-11-42-25-6-4-3-5-23(25)31(14-27(36)37)15-28(38)39/h3-8,10,13H,9,11-12,14-19H2,1-2H3,(H,36,37)(H,38,39) |
| InChIKey | FOFJZFJYYGWLNI-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 221.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.60 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|