C24H33NO3 — CID 125154595
[(1S)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-1-phenyl-3-piperidin-1-ylpropyl] (2S)-2-hydroxypropanoate (PubChem CID 125154595) has the molecular formula C24H33NO3 and a molecular weight of 383.53 g/mol. Its IUPAC name is [(1S)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-1-phenyl-3-piperidin-1-ylpropyl] (2S)-2-hydroxypropanoate.
| Compound Name | [(1S)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-1-phenyl-3-piperidin-1-ylpropyl] (2S)-2-hydroxypropanoate |
|---|---|
| PubChem CID | 125154595 |
| Molecular Formula | C24H33NO3 |
| Molecular Weight | 383.53 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | [(1S)-1-[(1S,2S,4S)-2-bicyclo[2.2.1]hept-5-enyl]-1-phenyl-3-piperidin-1-ylpropyl] (2S)-2-hydroxypropanoate |
| SMILES | C[C@H](O)C(=O)O[C@](CCN1CCCCC1)(c1ccccc1)[C@H]1C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C24H33NO3/c1-18(26)23(27)28-24(21-8-4-2-5-9-21,12-15-25-13-6-3-7-14-25)22-17-19-10-11-20(22)16-19/h2,4-5,8-11,18-20,22,26H,3,6-7,12-17H2,1H3/t18-,19-,20+,22-,24+/m0/s1 |
| InChIKey | ATZOURLUNRGDHW-MJRVOHGCSA-N |
| XLogP | 3.89 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|