C14H21NO2 — CID 18463283
2-pyrrolidin-1-ylethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 18463283) has the molecular formula C14H21NO2 and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-pyrrolidin-1-ylethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | 2-pyrrolidin-1-ylethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 18463283 |
| Molecular Formula | C14H21NO2 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.16 |
| IUPAC Name | 2-pyrrolidin-1-ylethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(OCCN1CCCC1)C1CC2C=CC1C2 |
| InChI | InChI=1S/C14H21NO2/c16-14(13-10-11-3-4-12(13)9-11)17-8-7-15-5-1-2-6-15/h3-4,11-13H,1-2,5-10H2 |
| InChIKey | SXTUNQXPADMNQE-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|