C15H23NO2 — CID 22955728
2-piperidin-1-ylethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate (PubChem CID 22955728) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is 2-piperidin-1-ylethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate.
| Compound Name | 2-piperidin-1-ylethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
|---|---|
| PubChem CID | 22955728 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | 2-piperidin-1-ylethyl bicyclo[2.2.1]hept-5-ene-2-carboxylate |
| SMILES | O=C(OCCN1CCCCC1)C1CC2C=CC1C2 |
| InChI | InChI=1S/C15H23NO2/c17-15(14-11-12-4-5-13(14)10-12)18-9-8-16-6-2-1-3-7-16/h4-5,12-14H,1-3,6-11H2 |
| InChIKey | JNDNVTKPLWVOLS-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|