C16H23N5O3 — CID 125162212
3-(3-aminopropoxy)-4-methoxy-N-[(1R)-1-(2-methyl-1,2,4-triazol-3-yl)ethyl]benzamide (PubChem CID 125162212) has the molecular formula C16H23N5O3 and a molecular weight of 333.39 g/mol. Its IUPAC name is 3-(3-aminopropoxy)-4-methoxy-N-[(1R)-1-(2-methyl-1,2,4-triazol-3-yl)ethyl]benzamide.
| Compound Name | 3-(3-aminopropoxy)-4-methoxy-N-[(1R)-1-(2-methyl-1,2,4-triazol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 125162212 |
| Molecular Formula | C16H23N5O3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.18 |
| IUPAC Name | 3-(3-aminopropoxy)-4-methoxy-N-[(1R)-1-(2-methyl-1,2,4-triazol-3-yl)ethyl]benzamide |
| SMILES | COc1ccc(C(=O)N[C@H](C)c2ncnn2C)cc1OCCCN |
| InChI | InChI=1S/C16H23N5O3/c1-11(15-18-10-19-21(15)2)20-16(22)12-5-6-13(23-3)14(9-12)24-8-4-7-17/h5-6,9-11H,4,7-8,17H2,1-3H3,(H,20,22)/t11-/m1/s1 |
| InChIKey | KQROBVKBWXSESR-LLVKDONJSA-N |
| XLogP | 1.04 |
| TPSA | 104.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|