C30H30N4O3S — CID 125168035
(3S)-N-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-[2-(2-methyl-1,3-benzothiazol-6-yl)-1,3-dioxoisoindol-4-yl]piperidine-3-carboxamide (PubChem CID 125168035) has the molecular formula C30H30N4O3S and a molecular weight of 526.66 g/mol. Its IUPAC name is (3S)-N-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-[2-(2-methyl-1,3-benzothiazol-6-yl)-1,3-dioxoisoindol-4-yl]piperidine-3-carboxamide.
| Compound Name | (3S)-N-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-[2-(2-methyl-1,3-benzothiazol-6-yl)-1,3-dioxoisoindol-4-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 125168035 |
| Molecular Formula | C30H30N4O3S |
| Molecular Weight | 526.66 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | (3S)-N-[[(1R,2S,4R)-2-bicyclo[2.2.1]hept-5-enyl]methyl]-1-[2-(2-methyl-1,3-benzothiazol-6-yl)-1,3-dioxoisoindol-4-yl]piperidine-3-carboxamide |
| SMILES | Cc1nc2ccc(N3C(=O)c4cccc(N5CCC[C@H](C(=O)NC[C@H]6C[C@@H]7C=C[C@H]6C7)C5)c4C3=O)cc2s1 |
| InChI | InChI=1S/C30H30N4O3S/c1-17-32-24-10-9-22(14-26(24)38-17)34-29(36)23-5-2-6-25(27(23)30(34)37)33-11-3-4-20(16-33)28(35)31-15-21-13-18-7-8-19(21)12-18/h2,5-10,14,18-21H,3-4,11-13,15-16H2,1H3,(H,31,35)/t18-,19+,20+,21-/m1/s1 |
| InChIKey | ARYXNWAFKYUCPW-IVAOSVALSA-N |
| XLogP | 4.95 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.66 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|