About ethyl N-pentanethioylcarbamate
ethyl N-pentanethioylcarbamate (PubChem CID 12517286) has the molecular formula C8H15NO2S
and a molecular weight of 189.28 g/mol. Its IUPAC name is ethyl N-pentanethioylcarbamate.
Molecular Properties
| Compound Name | ethyl N-pentanethioylcarbamate |
| PubChem CID | 12517286 |
| Molecular Formula | C8H15NO2S |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | ethyl N-pentanethioylcarbamate |
| SMILES | CCCCC(=S)NC(=O)OCC |
| InChI | InChI=1S/C8H15NO2S/c1-3-5-6-7(12)9-8(10)11-4-2/h3-6H2,1-2H3,(H,9,10,12) |
| InChIKey | YYEKHNBJKUBVCH-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze ethyl N-pentanethioylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl N-pentanethioylcarbamate?
The IUPAC name of ethyl N-pentanethioylcarbamate (CID 12517286) is ethyl N-pentanethioylcarbamate.
What is the SMILES notation for ethyl N-pentanethioylcarbamate?
The canonical SMILES for ethyl N-pentanethioylcarbamate is CCCCC(=S)NC(=O)OCC.
What is the InChIKey of ethyl N-pentanethioylcarbamate?
The InChIKey is YYEKHNBJKUBVCH-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2S/c1-3-5-6-7(12)9-8(10)11-4-2/h3-6H2,1-2H3,(H,9,10,12).
What are the key properties of ethyl N-pentanethioylcarbamate?
ethyl N-pentanethioylcarbamate has a molecular weight of 189.28 g/mol, XLogP of 2.25, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl N-pentanethioylcarbamate is sourced from PubChem (CID 12517286), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).