C6H8F3N3O3S — CID 117062162
ethyl N-[[(2,2,2-trifluoroacetyl)amino]carbamothioyl]carbamate (PubChem CID 117062162) has the molecular formula C6H8F3N3O3S and a molecular weight of 259.21 g/mol. Its IUPAC name is ethyl N-[[(2,2,2-trifluoroacetyl)amino]carbamothioyl]carbamate.
| Compound Name | ethyl N-[[(2,2,2-trifluoroacetyl)amino]carbamothioyl]carbamate |
|---|---|
| PubChem CID | 117062162 |
| Molecular Formula | C6H8F3N3O3S |
| Molecular Weight | 259.21 g/mol |
| Exact Mass | 259.02 |
| IUPAC Name | ethyl N-[[(2,2,2-trifluoroacetyl)amino]carbamothioyl]carbamate |
| SMILES | CCOC(=O)NC(=S)NNC(=O)C(F)(F)F |
| InChI | InChI=1S/C6H8F3N3O3S/c1-2-15-5(14)10-4(16)12-11-3(13)6(7,8)9/h2H2,1H3,(H,11,13)(H2,10,12,14,16) |
| InChIKey | KCJXQOKSEBSRMK-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.21 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|