C23H25N3O3 — CID 125173408
(6R)-4-(2,3-dimethyl-1H-indole-5-carbonyl)-1-(3-methoxyphenyl)-6-methylpiperazin-2-one (PubChem CID 125173408) has the molecular formula C23H25N3O3 and a molecular weight of 391.47 g/mol. Its IUPAC name is (6R)-4-(2,3-dimethyl-1H-indole-5-carbonyl)-1-(3-methoxyphenyl)-6-methylpiperazin-2-one.
| Compound Name | (6R)-4-(2,3-dimethyl-1H-indole-5-carbonyl)-1-(3-methoxyphenyl)-6-methylpiperazin-2-one |
|---|---|
| PubChem CID | 125173408 |
| Molecular Formula | C23H25N3O3 |
| Molecular Weight | 391.47 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | (6R)-4-(2,3-dimethyl-1H-indole-5-carbonyl)-1-(3-methoxyphenyl)-6-methylpiperazin-2-one |
| SMILES | COc1cccc(N2C(=O)CN(C(=O)c3ccc4[nH]c(C)c(C)c4c3)C[C@H]2C)c1 |
| InChI | InChI=1S/C23H25N3O3/c1-14-12-25(13-22(27)26(14)18-6-5-7-19(11-18)29-4)23(28)17-8-9-21-20(10-17)15(2)16(3)24-21/h5-11,14,24H,12-13H2,1-4H3/t14-/m1/s1 |
| InChIKey | BKNPJLQLEIHZCP-CQSZACIVSA-N |
| XLogP | 3.67 |
| TPSA | 65.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.47 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|