C20H23N3O4 — CID 125174059
3-(3-aminopropoxy)-4-methoxy-N-[(4R)-2-oxo-3,4-dihydro-1H-quinolin-4-yl]benzamide (PubChem CID 125174059) has the molecular formula C20H23N3O4 and a molecular weight of 369.42 g/mol. Its IUPAC name is 3-(3-aminopropoxy)-4-methoxy-N-[(4R)-2-oxo-3,4-dihydro-1H-quinolin-4-yl]benzamide.
| Compound Name | 3-(3-aminopropoxy)-4-methoxy-N-[(4R)-2-oxo-3,4-dihydro-1H-quinolin-4-yl]benzamide |
|---|---|
| PubChem CID | 125174059 |
| Molecular Formula | C20H23N3O4 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 3-(3-aminopropoxy)-4-methoxy-N-[(4R)-2-oxo-3,4-dihydro-1H-quinolin-4-yl]benzamide |
| SMILES | COc1ccc(C(=O)N[C@@H]2CC(=O)Nc3ccccc32)cc1OCCCN |
| InChI | InChI=1S/C20H23N3O4/c1-26-17-8-7-13(11-18(17)27-10-4-9-21)20(25)23-16-12-19(24)22-15-6-3-2-5-14(15)16/h2-3,5-8,11,16H,4,9-10,12,21H2,1H3,(H,22,24)(H,23,25)/t16-/m1/s1 |
| InChIKey | GHJKMLIVYJRIJP-MRXNPFEDSA-N |
| XLogP | 2.24 |
| TPSA | 102.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|