C15H18ClNO2S — CID 125180547
2-[(E)-2-(3-chlorophenyl)-1-piperidin-1-ylethenyl]sulfanylacetic acid (PubChem CID 125180547) has the molecular formula C15H18ClNO2S and a molecular weight of 311.83 g/mol. Its IUPAC name is 2-[(E)-2-(3-chlorophenyl)-1-piperidin-1-ylethenyl]sulfanylacetic acid.
| Compound Name | 2-[(E)-2-(3-chlorophenyl)-1-piperidin-1-ylethenyl]sulfanylacetic acid |
|---|---|
| PubChem CID | 125180547 |
| Molecular Formula | C15H18ClNO2S |
| Molecular Weight | 311.83 g/mol |
| Exact Mass | 311.07 |
| IUPAC Name | 2-[(E)-2-(3-chlorophenyl)-1-piperidin-1-ylethenyl]sulfanylacetic acid |
| SMILES | O=C(O)CS/C(=C/c1cccc(Cl)c1)N1CCCCC1 |
| InChI | InChI=1S/C15H18ClNO2S/c16-13-6-4-5-12(9-13)10-14(20-11-15(18)19)17-7-2-1-3-8-17/h4-6,9-10H,1-3,7-8,11H2,(H,18,19)/b14-10+ |
| InChIKey | ZIWSAJITMLKUHW-GXDHUFHOSA-N |
| XLogP | 3.94 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.83 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |