C22H22ClNO3S — CID 174216151
1-[(Z)-3-(3-chlorophenyl)-2-(phenylsulfanylmethyl)prop-2-enoyl]piperidine-3-carboxylic acid (PubChem CID 174216151) has the molecular formula C22H22ClNO3S and a molecular weight of 415.94 g/mol. Its IUPAC name is 1-[(Z)-3-(3-chlorophenyl)-2-(phenylsulfanylmethyl)prop-2-enoyl]piperidine-3-carboxylic acid.
| Compound Name | 1-[(Z)-3-(3-chlorophenyl)-2-(phenylsulfanylmethyl)prop-2-enoyl]piperidine-3-carboxylic acid |
|---|---|
| PubChem CID | 174216151 |
| Molecular Formula | C22H22ClNO3S |
| Molecular Weight | 415.94 g/mol |
| Exact Mass | 415.10 |
| IUPAC Name | 1-[(Z)-3-(3-chlorophenyl)-2-(phenylsulfanylmethyl)prop-2-enoyl]piperidine-3-carboxylic acid |
| SMILES | O=C(O)C1CCCN(C(=O)/C(=C/c2cccc(Cl)c2)CSc2ccccc2)C1 |
| InChI | InChI=1S/C22H22ClNO3S/c23-19-8-4-6-16(13-19)12-18(15-28-20-9-2-1-3-10-20)21(25)24-11-5-7-17(14-24)22(26)27/h1-4,6,8-10,12-13,17H,5,7,11,14-15H2,(H,26,27)/b18-12+ |
| InChIKey | CBFNAQKAAGEJTD-LDADJPATSA-N |
| XLogP | 4.84 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.94 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|