C14H15F3N4O2 — CID 125253263
(4aS,7aR)-4-prop-2-enyl-6-[6-(trifluoromethyl)pyrimidin-4-yl]-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one (PubChem CID 125253263) has the molecular formula C14H15F3N4O2 and a molecular weight of 328.29 g/mol. Its IUPAC name is (4aS,7aR)-4-prop-2-enyl-6-[6-(trifluoromethyl)pyrimidin-4-yl]-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one.
| Compound Name | (4aS,7aR)-4-prop-2-enyl-6-[6-(trifluoromethyl)pyrimidin-4-yl]-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 125253263 |
| Molecular Formula | C14H15F3N4O2 |
| Molecular Weight | 328.29 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | (4aS,7aR)-4-prop-2-enyl-6-[6-(trifluoromethyl)pyrimidin-4-yl]-4a,5,7,7a-tetrahydropyrrolo[3,4-b][1,4]oxazin-3-one |
| SMILES | C=CCN1C(=O)CO[C@@H]2CN(c3cc(C(F)(F)F)ncn3)C[C@@H]21 |
| InChI | InChI=1S/C14H15F3N4O2/c1-2-3-21-9-5-20(6-10(9)23-7-13(21)22)12-4-11(14(15,16)17)18-8-19-12/h2,4,8-10H,1,3,5-7H2/t9-,10+/m0/s1 |
| InChIKey | RMGDBVMOYCXDBL-VHSXEESVSA-N |
| XLogP | 1.10 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.29 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|