C13H13N2O5P — CID 12526671
2-[1,3-benzodioxol-5-yl(dimethoxyphosphoryl)methyl]propanedinitrile (PubChem CID 12526671) has the molecular formula C13H13N2O5P and a molecular weight of 308.23 g/mol. Its IUPAC name is 2-[1,3-benzodioxol-5-yl(dimethoxyphosphoryl)methyl]propanedinitrile.
| Compound Name | 2-[1,3-benzodioxol-5-yl(dimethoxyphosphoryl)methyl]propanedinitrile |
|---|---|
| PubChem CID | 12526671 |
| Molecular Formula | C13H13N2O5P |
| Molecular Weight | 308.23 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 2-[1,3-benzodioxol-5-yl(dimethoxyphosphoryl)methyl]propanedinitrile |
| SMILES | COP(=O)(OC)C(c1ccc2c(c1)OCO2)C(C#N)C#N |
| InChI | InChI=1S/C13H13N2O5P/c1-17-21(16,18-2)13(10(6-14)7-15)9-3-4-11-12(5-9)20-8-19-11/h3-5,10,13H,8H2,1-2H3 |
| InChIKey | WNDWPPPAVCZKMX-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 101.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.23 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|