C18H26N4O3 — CID 125319980
N-[[(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N'-(2-methoxy-3-pyridinyl)oxamide (PubChem CID 125319980) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is N-[[(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N'-(2-methoxy-3-pyridinyl)oxamide.
| Compound Name | N-[[(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N'-(2-methoxy-3-pyridinyl)oxamide |
|---|---|
| PubChem CID | 125319980 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | N-[[(1R,9aS)-2,3,4,6,7,8,9,9a-octahydro-1H-quinolizin-1-yl]methyl]-N'-(2-methoxy-3-pyridinyl)oxamide |
| SMILES | COc1ncccc1NC(=O)C(=O)NC[C@H]1CCCN2CCCC[C@@H]12 |
| InChI | InChI=1S/C18H26N4O3/c1-25-18-14(7-4-9-19-18)21-17(24)16(23)20-12-13-6-5-11-22-10-3-2-8-15(13)22/h4,7,9,13,15H,2-3,5-6,8,10-12H2,1H3,(H,20,23)(H,21,24)/t13-,15+/m1/s1 |
| InChIKey | QIYKAIKOCJOMFN-HIFRSBDPSA-N |
| XLogP | 1.41 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|