C17H13ClN2O6S — CID 12536368
1-(4-chlorophenyl)sulfonyl-3-(4-methoxyphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 12536368) has the molecular formula C17H13ClN2O6S and a molecular weight of 408.82 g/mol. Its IUPAC name is 1-(4-chlorophenyl)sulfonyl-3-(4-methoxyphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(4-chlorophenyl)sulfonyl-3-(4-methoxyphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 12536368 |
| Molecular Formula | C17H13ClN2O6S |
| Molecular Weight | 408.82 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | 1-(4-chlorophenyl)sulfonyl-3-(4-methoxyphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | COc1ccc(N2C(=O)CC(=O)N(S(=O)(=O)c3ccc(Cl)cc3)C2=O)cc1 |
| InChI | InChI=1S/C17H13ClN2O6S/c1-26-13-6-4-12(5-7-13)19-15(21)10-16(22)20(17(19)23)27(24,25)14-8-2-11(18)3-9-14/h2-9H,10H2,1H3 |
| InChIKey | KOGDKFXAHVHFTI-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 101.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.82 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|