C13H14N2O5 — CID 167474355
1-(3,5-dimethoxyphenyl)-3-methyl-1,3-diazinane-2,4,6-trione (PubChem CID 167474355) has the molecular formula C13H14N2O5 and a molecular weight of 278.26 g/mol. Its IUPAC name is 1-(3,5-dimethoxyphenyl)-3-methyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(3,5-dimethoxyphenyl)-3-methyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 167474355 |
| Molecular Formula | C13H14N2O5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.09 |
| IUPAC Name | 1-(3,5-dimethoxyphenyl)-3-methyl-1,3-diazinane-2,4,6-trione |
| SMILES | COc1cc(OC)cc(N2C(=O)CC(=O)N(C)C2=O)c1 |
| InChI | InChI=1S/C13H14N2O5/c1-14-11(16)7-12(17)15(13(14)18)8-4-9(19-2)6-10(5-8)20-3/h4-6H,7H2,1-3H3 |
| InChIKey | YWMISWXKQZTNNV-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|