C13H16N2O3 — CID 68674815
1-ethyl-7-methoxy-5-methyl-1,5-benzodiazepine-2,4-dione (PubChem CID 68674815) has the molecular formula C13H16N2O3 and a molecular weight of 248.28 g/mol. Its IUPAC name is 1-ethyl-7-methoxy-5-methyl-1,5-benzodiazepine-2,4-dione.
| Compound Name | 1-ethyl-7-methoxy-5-methyl-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 68674815 |
| Molecular Formula | C13H16N2O3 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.12 |
| IUPAC Name | 1-ethyl-7-methoxy-5-methyl-1,5-benzodiazepine-2,4-dione |
| SMILES | CCN1C(=O)CC(=O)N(C)c2cc(OC)ccc21 |
| InChI | InChI=1S/C13H16N2O3/c1-4-15-10-6-5-9(18-3)7-11(10)14(2)12(16)8-13(15)17/h5-7H,4,8H2,1-3H3 |
| InChIKey | YCDOOUPPAJXDHE-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|