C24H20F2N2O4S — CID 125418194
(3aR,10aS)-2-(benzenesulfonyl)-8-(2,4-difluorophenyl)-4-methyl-1,3,3a,10a-tetrahydropyrrolo[3,4-b][1,4]benzoxazepin-5-one (PubChem CID 125418194) has the molecular formula C24H20F2N2O4S and a molecular weight of 470.50 g/mol. Its IUPAC name is (3aR,10aS)-2-(benzenesulfonyl)-8-(2,4-difluorophenyl)-4-methyl-1,3,3a,10a-tetrahydropyrrolo[3,4-b][1,4]benzoxazepin-5-one.
| Compound Name | (3aR,10aS)-2-(benzenesulfonyl)-8-(2,4-difluorophenyl)-4-methyl-1,3,3a,10a-tetrahydropyrrolo[3,4-b][1,4]benzoxazepin-5-one |
|---|---|
| PubChem CID | 125418194 |
| Molecular Formula | C24H20F2N2O4S |
| Molecular Weight | 470.50 g/mol |
| Exact Mass | 470.11 |
| IUPAC Name | (3aR,10aS)-2-(benzenesulfonyl)-8-(2,4-difluorophenyl)-4-methyl-1,3,3a,10a-tetrahydropyrrolo[3,4-b][1,4]benzoxazepin-5-one |
| SMILES | CN1C(=O)c2ccc(-c3ccc(F)cc3F)cc2O[C@H]2CN(S(=O)(=O)c3ccccc3)C[C@H]21 |
| InChI | InChI=1S/C24H20F2N2O4S/c1-27-21-13-28(33(30,31)17-5-3-2-4-6-17)14-23(21)32-22-11-15(7-9-19(22)24(27)29)18-10-8-16(25)12-20(18)26/h2-12,21,23H,13-14H2,1H3/t21-,23+/m1/s1 |
| InChIKey | PJJLEDYKVSMFKS-GGAORHGYSA-N |
| XLogP | 3.54 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.50 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |