C12H14ClFN4OS — CID 125420685
4-butyl-3-[(6-chloro-5-fluoro-3-pyridinyl)methylsulfanyl]-1H-1,2,4-triazol-5-one (PubChem CID 125420685) has the molecular formula C12H14ClFN4OS and a molecular weight of 316.79 g/mol. Its IUPAC name is 4-butyl-3-[(6-chloro-5-fluoro-3-pyridinyl)methylsulfanyl]-1H-1,2,4-triazol-5-one.
| Compound Name | 4-butyl-3-[(6-chloro-5-fluoro-3-pyridinyl)methylsulfanyl]-1H-1,2,4-triazol-5-one |
|---|---|
| PubChem CID | 125420685 |
| Molecular Formula | C12H14ClFN4OS |
| Molecular Weight | 316.79 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 4-butyl-3-[(6-chloro-5-fluoro-3-pyridinyl)methylsulfanyl]-1H-1,2,4-triazol-5-one |
| SMILES | CCCCn1c(SCc2cnc(Cl)c(F)c2)n[nH]c1=O |
| InChI | InChI=1S/C12H14ClFN4OS/c1-2-3-4-18-11(19)16-17-12(18)20-7-8-5-9(14)10(13)15-6-8/h5-6H,2-4,7H2,1H3,(H,16,19) |
| InChIKey | MIGAFNBYWXEXHJ-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.79 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|