C19H21NO6 — CID 125428594
(4S)-6,7-dimethyl-4-(2,4,5-trimethoxyphenyl)-3,4-dihydropyrano[3,2-c]pyridine-2,5-dione (PubChem CID 125428594) has the molecular formula C19H21NO6 and a molecular weight of 359.38 g/mol. Its IUPAC name is (4S)-6,7-dimethyl-4-(2,4,5-trimethoxyphenyl)-3,4-dihydropyrano[3,2-c]pyridine-2,5-dione.
| Compound Name | (4S)-6,7-dimethyl-4-(2,4,5-trimethoxyphenyl)-3,4-dihydropyrano[3,2-c]pyridine-2,5-dione |
|---|---|
| PubChem CID | 125428594 |
| Molecular Formula | C19H21NO6 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.14 |
| IUPAC Name | (4S)-6,7-dimethyl-4-(2,4,5-trimethoxyphenyl)-3,4-dihydropyrano[3,2-c]pyridine-2,5-dione |
| SMILES | COc1cc(OC)c([C@@H]2CC(=O)Oc3cc(C)n(C)c(=O)c32)cc1OC |
| InChI | InChI=1S/C19H21NO6/c1-10-6-16-18(19(22)20(10)2)12(8-17(21)26-16)11-7-14(24-4)15(25-5)9-13(11)23-3/h6-7,9,12H,8H2,1-5H3/t12-/m0/s1 |
| InChIKey | PVXYIAVFMABULI-LBPRGKRZSA-N |
| XLogP | 2.16 |
| TPSA | 75.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |