C17H14N2O7 — CID 125431641
(4S)-6,7-dimethyl-4-(6-nitro-1,3-benzodioxol-5-yl)-3,4-dihydropyrano[3,2-c]pyridine-2,5-dione (PubChem CID 125431641) has the molecular formula C17H14N2O7 and a molecular weight of 358.31 g/mol. Its IUPAC name is (4S)-6,7-dimethyl-4-(6-nitro-1,3-benzodioxol-5-yl)-3,4-dihydropyrano[3,2-c]pyridine-2,5-dione.
| Compound Name | (4S)-6,7-dimethyl-4-(6-nitro-1,3-benzodioxol-5-yl)-3,4-dihydropyrano[3,2-c]pyridine-2,5-dione |
|---|---|
| PubChem CID | 125431641 |
| Molecular Formula | C17H14N2O7 |
| Molecular Weight | 358.31 g/mol |
| Exact Mass | 358.08 |
| IUPAC Name | (4S)-6,7-dimethyl-4-(6-nitro-1,3-benzodioxol-5-yl)-3,4-dihydropyrano[3,2-c]pyridine-2,5-dione |
| SMILES | Cc1cc2c(c(=O)n1C)[C@H](c1cc3c(cc1[N+](=O)[O-])OCO3)CC(=O)O2 |
| InChI | InChI=1S/C17H14N2O7/c1-8-3-14-16(17(21)18(8)2)10(5-15(20)26-14)9-4-12-13(25-7-24-12)6-11(9)19(22)23/h3-4,6,10H,5,7H2,1-2H3/t10-/m0/s1 |
| InChIKey | OBYLZKRDLOKVQO-JTQLQIEISA-N |
| XLogP | 1.77 |
| TPSA | 109.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.31 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|