C20H16N2O6 — CID 125433131
(4S)-6,7-dimethyl-4-[5-(2-nitrophenyl)furan-2-yl]-3,4-dihydropyrano[3,2-c]pyridine-2,5-dione (PubChem CID 125433131) has the molecular formula C20H16N2O6 and a molecular weight of 380.36 g/mol. Its IUPAC name is (4S)-6,7-dimethyl-4-[5-(2-nitrophenyl)furan-2-yl]-3,4-dihydropyrano[3,2-c]pyridine-2,5-dione.
| Compound Name | (4S)-6,7-dimethyl-4-[5-(2-nitrophenyl)furan-2-yl]-3,4-dihydropyrano[3,2-c]pyridine-2,5-dione |
|---|---|
| PubChem CID | 125433131 |
| Molecular Formula | C20H16N2O6 |
| Molecular Weight | 380.36 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | (4S)-6,7-dimethyl-4-[5-(2-nitrophenyl)furan-2-yl]-3,4-dihydropyrano[3,2-c]pyridine-2,5-dione |
| SMILES | Cc1cc2c(c(=O)n1C)[C@@H](c1ccc(-c3ccccc3[N+](=O)[O-])o1)CC(=O)O2 |
| InChI | InChI=1S/C20H16N2O6/c1-11-9-17-19(20(24)21(11)2)13(10-18(23)28-17)16-8-7-15(27-16)12-5-3-4-6-14(12)22(25)26/h3-9,13H,10H2,1-2H3/t13-/m1/s1 |
| InChIKey | RVFKNAURQXVVIG-CYBMUJFWSA-N |
| XLogP | 3.30 |
| TPSA | 104.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.36 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|