C20H24N4O6 — CID 125432006
5-[(R)-(3-hydroxy-4-methoxyphenyl)-(1,4,5-trimethyl-3-oxidoimidazol-3-ium-2-yl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione (PubChem CID 125432006) has the molecular formula C20H24N4O6 and a molecular weight of 416.43 g/mol. Its IUPAC name is 5-[(R)-(3-hydroxy-4-methoxyphenyl)-(1,4,5-trimethyl-3-oxidoimidazol-3-ium-2-yl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(R)-(3-hydroxy-4-methoxyphenyl)-(1,4,5-trimethyl-3-oxidoimidazol-3-ium-2-yl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 125432006 |
| Molecular Formula | C20H24N4O6 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 5-[(R)-(3-hydroxy-4-methoxyphenyl)-(1,4,5-trimethyl-3-oxidoimidazol-3-ium-2-yl)methyl]-1,3-dimethyl-1,3-diazinane-2,4,6-trione |
| SMILES | COc1ccc([C@H](c2n(C)c(C)c(C)[n+]2[O-])C2C(=O)N(C)C(=O)N(C)C2=O)cc1O |
| InChI | InChI=1S/C20H24N4O6/c1-10-11(2)24(29)17(21(10)3)15(12-7-8-14(30-6)13(25)9-12)16-18(26)22(4)20(28)23(5)19(16)27/h7-9,15-16,25H,1-6H3/t15-/m0/s1 |
| InChIKey | QCHQSSLGKCPNOK-HNNXBMFYSA-N |
| XLogP | 0.79 |
| TPSA | 119.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|