C15H21N5O — CID 125443911
[(2S)-2,5-dihydro-1H-pyrrol-2-yl]-[4-(6-ethylpyrimidin-4-yl)piperazin-1-yl]methanone (PubChem CID 125443911) has the molecular formula C15H21N5O and a molecular weight of 287.37 g/mol. Its IUPAC name is [(2S)-2,5-dihydro-1H-pyrrol-2-yl]-[4-(6-ethylpyrimidin-4-yl)piperazin-1-yl]methanone.
| Compound Name | [(2S)-2,5-dihydro-1H-pyrrol-2-yl]-[4-(6-ethylpyrimidin-4-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 125443911 |
| Molecular Formula | C15H21N5O |
| Molecular Weight | 287.37 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | [(2S)-2,5-dihydro-1H-pyrrol-2-yl]-[4-(6-ethylpyrimidin-4-yl)piperazin-1-yl]methanone |
| SMILES | CCc1cc(N2CCN(C(=O)[C@@H]3C=CCN3)CC2)ncn1 |
| InChI | InChI=1S/C15H21N5O/c1-2-12-10-14(18-11-17-12)19-6-8-20(9-7-19)15(21)13-4-3-5-16-13/h3-4,10-11,13,16H,2,5-9H2,1H3/t13-/m0/s1 |
| InChIKey | MPIWSXCMZZQPER-ZDUSSCGKSA-N |
| XLogP | 0.22 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.37 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|