C21H23N5O2 — CID 125445203
N-[(1S)-1-(cyclohexen-1-yl)ethyl]-3-(2-methyl-7-oxo-6H-pyrazolo[1,5-d][1,2,4]triazin-3-yl)benzamide (PubChem CID 125445203) has the molecular formula C21H23N5O2 and a molecular weight of 377.45 g/mol. Its IUPAC name is N-[(1S)-1-(cyclohexen-1-yl)ethyl]-3-(2-methyl-7-oxo-6H-pyrazolo[1,5-d][1,2,4]triazin-3-yl)benzamide.
| Compound Name | N-[(1S)-1-(cyclohexen-1-yl)ethyl]-3-(2-methyl-7-oxo-6H-pyrazolo[1,5-d][1,2,4]triazin-3-yl)benzamide |
|---|---|
| PubChem CID | 125445203 |
| Molecular Formula | C21H23N5O2 |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.19 |
| IUPAC Name | N-[(1S)-1-(cyclohexen-1-yl)ethyl]-3-(2-methyl-7-oxo-6H-pyrazolo[1,5-d][1,2,4]triazin-3-yl)benzamide |
| SMILES | Cc1nn2c(=O)[nH]ncc2c1-c1cccc(C(=O)N[C@@H](C)C2=CCCCC2)c1 |
| InChI | InChI=1S/C21H23N5O2/c1-13(15-7-4-3-5-8-15)23-20(27)17-10-6-9-16(11-17)19-14(2)25-26-18(19)12-22-24-21(26)28/h6-7,9-13H,3-5,8H2,1-2H3,(H,23,27)(H,24,28)/t13-/m0/s1 |
| InChIKey | HTJRPMPUKRUHOR-ZDUSSCGKSA-N |
| XLogP | 3.01 |
| TPSA | 92.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|