C21H23N3O2 — CID 125445329
4-(1,4-dimethylindazol-3-yl)-N-[[(2S)-oxolan-2-yl]methyl]benzamide (PubChem CID 125445329) has the molecular formula C21H23N3O2 and a molecular weight of 349.43 g/mol. Its IUPAC name is 4-(1,4-dimethylindazol-3-yl)-N-[[(2S)-oxolan-2-yl]methyl]benzamide.
| Compound Name | 4-(1,4-dimethylindazol-3-yl)-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 125445329 |
| Molecular Formula | C21H23N3O2 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 4-(1,4-dimethylindazol-3-yl)-N-[[(2S)-oxolan-2-yl]methyl]benzamide |
| SMILES | Cc1cccc2c1c(-c1ccc(C(=O)NC[C@@H]3CCCO3)cc1)nn2C |
| InChI | InChI=1S/C21H23N3O2/c1-14-5-3-7-18-19(14)20(23-24(18)2)15-8-10-16(11-9-15)21(25)22-13-17-6-4-12-26-17/h3,5,7-11,17H,4,6,12-13H2,1-2H3,(H,22,25)/t17-/m0/s1 |
| InChIKey | VHKQNXHUYHFDRE-KRWDZBQOSA-N |
| XLogP | 3.46 |
| TPSA | 56.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |