C17H26N2O3S — CID 125445384
1-(2-cyclohexylsulfanylethyl)-3-[(2S)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]urea (PubChem CID 125445384) has the molecular formula C17H26N2O3S and a molecular weight of 338.47 g/mol. Its IUPAC name is 1-(2-cyclohexylsulfanylethyl)-3-[(2S)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]urea.
| Compound Name | 1-(2-cyclohexylsulfanylethyl)-3-[(2S)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]urea |
|---|---|
| PubChem CID | 125445384 |
| Molecular Formula | C17H26N2O3S |
| Molecular Weight | 338.47 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | 1-(2-cyclohexylsulfanylethyl)-3-[(2S)-2-hydroxy-2-(3-hydroxyphenyl)ethyl]urea |
| SMILES | O=C(NCCSC1CCCCC1)NC[C@@H](O)c1cccc(O)c1 |
| InChI | InChI=1S/C17H26N2O3S/c20-14-6-4-5-13(11-14)16(21)12-19-17(22)18-9-10-23-15-7-2-1-3-8-15/h4-6,11,15-16,20-21H,1-3,7-10,12H2,(H2,18,19,22)/t16-/m1/s1 |
| InChIKey | JCQXJYSDUOQXCX-MRXNPFEDSA-N |
| XLogP | 2.79 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.47 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|