C14H15F2N3O3S — CID 125447012
5-(difluoromethyl)-N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]-1H-pyrazole-3-carboxamide (PubChem CID 125447012) has the molecular formula C14H15F2N3O3S and a molecular weight of 343.36 g/mol. Its IUPAC name is 5-(difluoromethyl)-N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]-1H-pyrazole-3-carboxamide.
| Compound Name | 5-(difluoromethyl)-N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]-1H-pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 125447012 |
| Molecular Formula | C14H15F2N3O3S |
| Molecular Weight | 343.36 g/mol |
| Exact Mass | 343.08 |
| IUPAC Name | 5-(difluoromethyl)-N-[(1S)-1-(4-methylsulfonylphenyl)ethyl]-1H-pyrazole-3-carboxamide |
| SMILES | C[C@H](NC(=O)c1cc(C(F)F)[nH]n1)c1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C14H15F2N3O3S/c1-8(9-3-5-10(6-4-9)23(2,21)22)17-14(20)12-7-11(13(15)16)18-19-12/h3-8,13H,1-2H3,(H,17,20)(H,18,19)/t8-/m0/s1 |
| InChIKey | HIIYSLSYZCFVOG-QMMMGPOBSA-N |
| XLogP | 2.24 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.36 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |