C20H29N3O3S — CID 47046888
1-tert-butyl-N-[1-(4-methylsulfonylphenyl)ethyl]-5-propan-2-ylpyrazole-3-carboxamide (PubChem CID 47046888) has the molecular formula C20H29N3O3S and a molecular weight of 391.54 g/mol. Its IUPAC name is 1-tert-butyl-N-[1-(4-methylsulfonylphenyl)ethyl]-5-propan-2-ylpyrazole-3-carboxamide.
| Compound Name | 1-tert-butyl-N-[1-(4-methylsulfonylphenyl)ethyl]-5-propan-2-ylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 47046888 |
| Molecular Formula | C20H29N3O3S |
| Molecular Weight | 391.54 g/mol |
| Exact Mass | 391.19 |
| IUPAC Name | 1-tert-butyl-N-[1-(4-methylsulfonylphenyl)ethyl]-5-propan-2-ylpyrazole-3-carboxamide |
| SMILES | CC(C)c1cc(C(=O)NC(C)c2ccc(S(C)(=O)=O)cc2)nn1C(C)(C)C |
| InChI | InChI=1S/C20H29N3O3S/c1-13(2)18-12-17(22-23(18)20(4,5)6)19(24)21-14(3)15-8-10-16(11-9-15)27(7,25)26/h8-14H,1-7H3,(H,21,24) |
| InChIKey | BYTGDUWAHHAWIS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.54 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |