C15H17N5O — CID 125447493
(1R)-N-[[3-(2H-tetrazol-5-yl)phenyl]methyl]cyclohex-3-ene-1-carboxamide (PubChem CID 125447493) has the molecular formula C15H17N5O and a molecular weight of 283.33 g/mol. Its IUPAC name is (1R)-N-[[3-(2H-tetrazol-5-yl)phenyl]methyl]cyclohex-3-ene-1-carboxamide.
| Compound Name | (1R)-N-[[3-(2H-tetrazol-5-yl)phenyl]methyl]cyclohex-3-ene-1-carboxamide |
|---|---|
| PubChem CID | 125447493 |
| Molecular Formula | C15H17N5O |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.14 |
| IUPAC Name | (1R)-N-[[3-(2H-tetrazol-5-yl)phenyl]methyl]cyclohex-3-ene-1-carboxamide |
| SMILES | O=C(NCc1cccc(-c2nn[nH]n2)c1)[C@H]1CC=CCC1 |
| InChI | InChI=1S/C15H17N5O/c21-15(12-6-2-1-3-7-12)16-10-11-5-4-8-13(9-11)14-17-19-20-18-14/h1-2,4-5,8-9,12H,3,6-7,10H2,(H,16,21)(H,17,18,19,20)/t12-/m0/s1 |
| InChIKey | HIXKZISOVYXRES-LBPRGKRZSA-N |
| XLogP | 1.84 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|