C19H24N6O3 — CID 91844312
1-(oxolane-2-carbonyl)-N-[[3-(2H-tetrazol-5-yl)phenyl]methyl]piperidine-4-carboxamide (PubChem CID 91844312) has the molecular formula C19H24N6O3 and a molecular weight of 384.44 g/mol. Its IUPAC name is 1-(oxolane-2-carbonyl)-N-[[3-(2H-tetrazol-5-yl)phenyl]methyl]piperidine-4-carboxamide.
| Compound Name | 1-(oxolane-2-carbonyl)-N-[[3-(2H-tetrazol-5-yl)phenyl]methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 91844312 |
| Molecular Formula | C19H24N6O3 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.19 |
| IUPAC Name | 1-(oxolane-2-carbonyl)-N-[[3-(2H-tetrazol-5-yl)phenyl]methyl]piperidine-4-carboxamide |
| SMILES | O=C(NCc1cccc(-c2nn[nH]n2)c1)C1CCN(C(=O)C2CCCO2)CC1 |
| InChI | InChI=1S/C19H24N6O3/c26-18(14-6-8-25(9-7-14)19(27)16-5-2-10-28-16)20-12-13-3-1-4-15(11-13)17-21-23-24-22-17/h1,3-4,11,14,16H,2,5-10,12H2,(H,20,26)(H,21,22,23,24) |
| InChIKey | MXKHNFXEHRQVIM-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 113.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |